About (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene
(4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene (PubChem CID 158514528) has the molecular formula C11H9AsN2O
and a molecular weight of 260.13 g/mol. Its IUPAC name is (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene.
Molecular Properties
| Compound Name | (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene |
| PubChem CID | 158514528 |
| Molecular Formula | C11H9AsN2O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene |
| SMILES | O=[As]c1ccc(/N=N/C2=CC=CC2)cc1 |
| InChI | InChI=1S/C11H9AsN2O/c15-12-9-5-7-11(8-6-9)14-13-10-3-1-2-4-10/h1-3,5-8H,4H2/b14-13+ |
| InChIKey | HLLVGIVKCDRYJG-BUHFOSPRSA-N |
| XLogP | 2.29 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene?
The IUPAC name of (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene (CID 158514528) is (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene.
What is the SMILES notation for (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene?
The canonical SMILES for (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene is O=[As]c1ccc(/N=N/C2=CC=CC2)cc1.
What is the InChIKey of (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene?
The InChIKey is HLLVGIVKCDRYJG-BUHFOSPRSA-N. The full InChI is InChI=1S/C11H9AsN2O/c15-12-9-5-7-11(8-6-9)14-13-10-3-1-2-4-10/h1-3,5-8H,4H2/b14-13+.
What are the key properties of (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene?
(4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene has a molecular weight of 260.13 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-arsorosophenyl)-cyclopenta-1,3-dien-1-yldiazene is sourced from PubChem (CID 158514528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).