C36H44N4O4 — CID 158514765
5-tert-butyl-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide;N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide (PubChem CID 158514765) has the molecular formula C36H44N4O4 and a molecular weight of 596.77 g/mol. Its IUPAC name is 5-tert-butyl-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide;N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide;N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 158514765 |
| Molecular Formula | C36H44N4O4 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 5-tert-butyl-N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide;N-(3,4-dimethylphenyl)-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2noc3c2CC(C(C)(C)C)CC3)cc1C.Cc1ccc(NC(=O)c2noc3c2CCCC3)cc1C |
| InChI | InChI=1S/C20H26N2O2.C16H18N2O2/c1-12-6-8-15(10-13(12)2)21-19(23)18-16-11-14(20(3,4)5)7-9-17(16)24-22-18;1-10-7-8-12(9-11(10)2)17-16(19)15-13-5-3-4-6-14(13)20-18-15/h6,8,10,14H,7,9,11H2,1-5H3,(H,21,23);7-9H,3-6H2,1-2H3,(H,17,19) |
| InChIKey | HLMKSJSDPIWPCM-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |