About chloromethylbenzene;triphenyl phosphite
chloromethylbenzene;triphenyl phosphite (PubChem CID 158515222) has the molecular formula C25H22ClO3P
and a molecular weight of 436.88 g/mol. Its IUPAC name is chloromethylbenzene;triphenyl phosphite.
Molecular Properties
| Compound Name | chloromethylbenzene;triphenyl phosphite |
| PubChem CID | 158515222 |
| Molecular Formula | C25H22ClO3P |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | chloromethylbenzene;triphenyl phosphite |
| SMILES | ClCc1ccccc1.c1ccc(OP(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H15O3P.C7H7Cl/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;1-5H,6H2 |
| InChIKey | HLNUWVPDCQFOPQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;triphenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;triphenyl phosphite?
The IUPAC name of chloromethylbenzene;triphenyl phosphite (CID 158515222) is chloromethylbenzene;triphenyl phosphite.
What is the SMILES notation for chloromethylbenzene;triphenyl phosphite?
The canonical SMILES for chloromethylbenzene;triphenyl phosphite is ClCc1ccccc1.c1ccc(OP(Oc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of chloromethylbenzene;triphenyl phosphite?
The InChIKey is HLNUWVPDCQFOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O3P.C7H7Cl/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;1-5H,6H2.
What are the key properties of chloromethylbenzene;triphenyl phosphite?
chloromethylbenzene;triphenyl phosphite has a molecular weight of 436.88 g/mol, XLogP of 7.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;triphenyl phosphite is sourced from PubChem (CID 158515222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).