About (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one
(E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one (PubChem CID 15851641) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one.
Molecular Properties
| Compound Name | (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one |
| PubChem CID | 15851641 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one |
| SMILES | CCC(/C=C/C(=O)C(C)(C)C)=N\O |
| InChI | InChI=1S/C10H17NO2/c1-5-8(11-13)6-7-9(12)10(2,3)4/h6-7,13H,5H2,1-4H3/b7-6+,11-8+ |
| InChIKey | FXHNXIYFOXYTPB-HRCSPUOPSA-N |
| XLogP | 2.40 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one?
The IUPAC name of (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one (CID 15851641) is (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one.
What is the SMILES notation for (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one?
The canonical SMILES for (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one is CCC(/C=C/C(=O)C(C)(C)C)=N\O.
What is the InChIKey of (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one?
The InChIKey is FXHNXIYFOXYTPB-HRCSPUOPSA-N. The full InChI is InChI=1S/C10H17NO2/c1-5-8(11-13)6-7-9(12)10(2,3)4/h6-7,13H,5H2,1-4H3/b7-6+,11-8+.
What are the key properties of (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one?
(E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one has a molecular weight of 183.25 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6E)-6-hydroxyimino-2,2-dimethyloct-4-en-3-one is sourced from PubChem (CID 15851641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).