C29H52O5 — CID 158516623
(2R,3S,4R)-4-ethyl-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)cyclopentan-1-one (PubChem CID 158516623) has the molecular formula C29H52O5 and a molecular weight of 480.73 g/mol. Its IUPAC name is (2R,3S,4R)-4-ethyl-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)cyclopentan-1-one.
| Compound Name | (2R,3S,4R)-4-ethyl-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 158516623 |
| Molecular Formula | C29H52O5 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | (2R,3S,4R)-4-ethyl-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)cyclopentan-1-one |
| SMILES | CCCCCCCC1(CC[C@H]2[C@H](CC)CC(=O)[C@@H]2CC=CCCCC(OO)C(C)C)OCCO1 |
| InChI | InChI=1S/C29H52O5/c1-5-7-8-11-14-18-29(32-20-21-33-29)19-17-25-24(6-2)22-27(30)26(25)15-12-9-10-13-16-28(34-31)23(3)4/h9,12,23-26,28,31H,5-8,10-11,13-22H2,1-4H3/t24-,25+,26-,28?/m1/s1 |
| InChIKey | WKIGFZVJRIYJNC-XGQFQGBFSA-N |
| XLogP | 7.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|