About 1H-azepine;3H-benzo[e]benzimidazole
1H-azepine;3H-benzo[e]benzimidazole (PubChem CID 158517761) has the molecular formula C17H15N3
and a molecular weight of 261.33 g/mol. Its IUPAC name is 1H-azepine;3H-benzo[e]benzimidazole.
Molecular Properties
| Compound Name | 1H-azepine;3H-benzo[e]benzimidazole |
| PubChem CID | 158517761 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1H-azepine;3H-benzo[e]benzimidazole |
| SMILES | C1=CC=CNC=C1.c1ccc2c(c1)ccc1[nH]cnc12 |
| InChI | InChI=1S/C11H8N2.C6H7N/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10;1-2-4-6-7-5-3-1/h1-7H,(H,12,13);1-7H |
| InChIKey | HLVKYKKGEJMBKJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-azepine;3H-benzo[e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;3H-benzo[e]benzimidazole?
The IUPAC name of 1H-azepine;3H-benzo[e]benzimidazole (CID 158517761) is 1H-azepine;3H-benzo[e]benzimidazole.
What is the SMILES notation for 1H-azepine;3H-benzo[e]benzimidazole?
The canonical SMILES for 1H-azepine;3H-benzo[e]benzimidazole is C1=CC=CNC=C1.c1ccc2c(c1)ccc1[nH]cnc12.
What is the InChIKey of 1H-azepine;3H-benzo[e]benzimidazole?
The InChIKey is HLVKYKKGEJMBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.C6H7N/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10;1-2-4-6-7-5-3-1/h1-7H,(H,12,13);1-7H.
What are the key properties of 1H-azepine;3H-benzo[e]benzimidazole?
1H-azepine;3H-benzo[e]benzimidazole has a molecular weight of 261.33 g/mol, XLogP of 3.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;3H-benzo[e]benzimidazole is sourced from PubChem (CID 158517761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).