C19H32N2O4 — CID 158518217
ditert-butyl 3,4,7,8,9,10-hexahydro-2H-pyrimido[1,2-a]azepine-6,6-dicarboxylate (PubChem CID 158518217) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is ditert-butyl 3,4,7,8,9,10-hexahydro-2H-pyrimido[1,2-a]azepine-6,6-dicarboxylate.
| Compound Name | ditert-butyl 3,4,7,8,9,10-hexahydro-2H-pyrimido[1,2-a]azepine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 158518217 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ditert-butyl 3,4,7,8,9,10-hexahydro-2H-pyrimido[1,2-a]azepine-6,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)CCCCC2=NCCCN21 |
| InChI | InChI=1S/C19H32N2O4/c1-17(2,3)24-15(22)19(16(23)25-18(4,5)6)11-8-7-10-14-20-12-9-13-21(14)19/h7-13H2,1-6H3 |
| InChIKey | HLWVLKPFLCXPAQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|