About 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole
5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole (PubChem CID 158518257) has the molecular formula C13H13NO2S
and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole.
Molecular Properties
| Compound Name | 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole |
| PubChem CID | 158518257 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole |
| SMILES | c1cc(-c2ccc(C3COCCO3)cc2)sn1 |
| InChI | InChI=1S/C13H13NO2S/c1-3-11(13-5-6-14-17-13)4-2-10(1)12-9-15-7-8-16-12/h1-6,12H,7-9H2 |
| InChIKey | HLWXPANZAHHCGT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole?
The IUPAC name of 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole (CID 158518257) is 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole.
What is the SMILES notation for 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole?
The canonical SMILES for 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole is c1cc(-c2ccc(C3COCCO3)cc2)sn1.
What is the InChIKey of 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole?
The InChIKey is HLWXPANZAHHCGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2S/c1-3-11(13-5-6-14-17-13)4-2-10(1)12-9-15-7-8-16-12/h1-6,12H,7-9H2.
What are the key properties of 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole?
5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole has a molecular weight of 247.32 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1,4-dioxan-2-yl)phenyl]-1,2-thiazole is sourced from PubChem (CID 158518257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).