About dimethoxy(phenyl)silane;silane
dimethoxy(phenyl)silane;silane (PubChem CID 158518395) has the molecular formula C8H16O2Si2
and a molecular weight of 200.39 g/mol. Its IUPAC name is dimethoxy(phenyl)silane;silane.
Molecular Properties
| Compound Name | dimethoxy(phenyl)silane;silane |
| PubChem CID | 158518395 |
| Molecular Formula | C8H16O2Si2 |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | dimethoxy(phenyl)silane;silane |
| SMILES | CO[SiH](OC)c1ccccc1.[SiH4] |
| InChI | InChI=1S/C8H12O2Si.H4Si/c1-9-11(10-2)8-6-4-3-5-7-8;/h3-7,11H,1-2H3;1H4 |
| InChIKey | HLXHRTYJGGLEEZ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(phenyl)silane;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(phenyl)silane;silane?
The IUPAC name of dimethoxy(phenyl)silane;silane (CID 158518395) is dimethoxy(phenyl)silane;silane.
What is the SMILES notation for dimethoxy(phenyl)silane;silane?
The canonical SMILES for dimethoxy(phenyl)silane;silane is CO[SiH](OC)c1ccccc1.[SiH4].
What is the InChIKey of dimethoxy(phenyl)silane;silane?
The InChIKey is HLXHRTYJGGLEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2Si.H4Si/c1-9-11(10-2)8-6-4-3-5-7-8;/h3-7,11H,1-2H3;1H4.
What are the key properties of dimethoxy(phenyl)silane;silane?
dimethoxy(phenyl)silane;silane has a molecular weight of 200.39 g/mol, XLogP of -1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(phenyl)silane;silane is sourced from PubChem (CID 158518395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).