C14H15N2S+ — CID 158519574
9-ethyl-2,8-dimethyl-[1,3]thiazolo[4,5-h]isoquinolin-8-ium (PubChem CID 158519574) has the molecular formula C14H15N2S+ and a molecular weight of 243.35 g/mol. Its IUPAC name is 9-ethyl-2,8-dimethyl-[1,3]thiazolo[4,5-h]isoquinolin-8-ium.
| Compound Name | 9-ethyl-2,8-dimethyl-[1,3]thiazolo[4,5-h]isoquinolin-8-ium |
|---|---|
| PubChem CID | 158519574 |
| Molecular Formula | C14H15N2S+ |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 9-ethyl-2,8-dimethyl-[1,3]thiazolo[4,5-h]isoquinolin-8-ium |
| SMILES | CCc1c2c(ccc3nc(C)sc32)cc[n+]1C |
| InChI | InChI=1S/C14H15N2S/c1-4-12-13-10(7-8-16(12)3)5-6-11-14(13)17-9(2)15-11/h5-8H,4H2,1-3H3/q+1 |
| InChIKey | HNOPDYOQQMPFLU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|