About (Z)-6-bromo-1,1-diethoxyhex-3-ene
(Z)-6-bromo-1,1-diethoxyhex-3-ene (PubChem CID 15851979) has the molecular formula C10H19BrO2
and a molecular weight of 251.16 g/mol. Its IUPAC name is (Z)-6-bromo-1,1-diethoxyhex-3-ene.
Molecular Properties
| Compound Name | (Z)-6-bromo-1,1-diethoxyhex-3-ene |
| PubChem CID | 15851979 |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (Z)-6-bromo-1,1-diethoxyhex-3-ene |
| SMILES | CCOC(C/C=C\CCBr)OCC |
| InChI | InChI=1S/C10H19BrO2/c1-3-12-10(13-4-2)8-6-5-7-9-11/h5-6,10H,3-4,7-9H2,1-2H3/b6-5- |
| InChIKey | DIAITKDRAFWBCR-WAYWQWQTSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-bromo-1,1-diethoxyhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-bromo-1,1-diethoxyhex-3-ene?
The IUPAC name of (Z)-6-bromo-1,1-diethoxyhex-3-ene (CID 15851979) is (Z)-6-bromo-1,1-diethoxyhex-3-ene.
What is the SMILES notation for (Z)-6-bromo-1,1-diethoxyhex-3-ene?
The canonical SMILES for (Z)-6-bromo-1,1-diethoxyhex-3-ene is CCOC(C/C=C\CCBr)OCC.
What is the InChIKey of (Z)-6-bromo-1,1-diethoxyhex-3-ene?
The InChIKey is DIAITKDRAFWBCR-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H19BrO2/c1-3-12-10(13-4-2)8-6-5-7-9-11/h5-6,10H,3-4,7-9H2,1-2H3/b6-5-.
What are the key properties of (Z)-6-bromo-1,1-diethoxyhex-3-ene?
(Z)-6-bromo-1,1-diethoxyhex-3-ene has a molecular weight of 251.16 g/mol, XLogP of 3.12, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-bromo-1,1-diethoxyhex-3-ene is sourced from PubChem (CID 15851979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).