C14H21NO — CID 15851991
4-methoxy-2,2,4,6-tetramethyl-1,3-dihydroquinoline (PubChem CID 15851991) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-methoxy-2,2,4,6-tetramethyl-1,3-dihydroquinoline.
| Compound Name | 4-methoxy-2,2,4,6-tetramethyl-1,3-dihydroquinoline |
|---|---|
| PubChem CID | 15851991 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-methoxy-2,2,4,6-tetramethyl-1,3-dihydroquinoline |
| SMILES | COC1(C)CC(C)(C)Nc2ccc(C)cc21 |
| InChI | InChI=1S/C14H21NO/c1-10-6-7-12-11(8-10)14(4,16-5)9-13(2,3)15-12/h6-8,15H,9H2,1-5H3 |
| InChIKey | KYOSSIGHRLTEKZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |