About 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid
5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid (PubChem CID 158520026) has the molecular formula C23H31O3P
and a molecular weight of 386.47 g/mol. Its IUPAC name is 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid.
Molecular Properties
| Compound Name | 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid |
| PubChem CID | 158520026 |
| Molecular Formula | C23H31O3P |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid |
| SMILES | CCCc1ccc(C=CCCCP(=O)(O)c2ccccc2O)c(CCC)c1 |
| InChI | InChI=1S/C23H31O3P/c1-3-10-19-15-16-20(21(18-19)11-4-2)12-6-5-9-17-27(25,26)23-14-8-7-13-22(23)24/h6-8,12-16,18,24H,3-5,9-11,17H2,1-2H3,(H,25,26) |
| InChIKey | BDGCWEHKVDGVMQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid?
The IUPAC name of 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid (CID 158520026) is 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid.
What is the SMILES notation for 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid?
The canonical SMILES for 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid is CCCc1ccc(C=CCCCP(=O)(O)c2ccccc2O)c(CCC)c1.
What is the InChIKey of 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid?
The InChIKey is BDGCWEHKVDGVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31O3P/c1-3-10-19-15-16-20(21(18-19)11-4-2)12-6-5-9-17-27(25,26)23-14-8-7-13-22(23)24/h6-8,12-16,18,24H,3-5,9-11,17H2,1-2H3,(H,25,26).
What are the key properties of 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid?
5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid has a molecular weight of 386.47 g/mol, XLogP of 5.69, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dipropylphenyl)pent-4-enyl-(2-hydroxyphenyl)phosphinic acid is sourced from PubChem (CID 158520026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).