C29H38N2O3 — CID 158520379
2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone (PubChem CID 158520379) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone.
| Compound Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 158520379 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1-(5-methyl-1H-imidazol-2-yl)ethanone |
| SMILES | Cc1cnc(C(=O)Cc2ccc(C3(O)[C@H](C)C4CC[C@@H](O4)[C@@H]3C)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C29H38N2O3/c1-17-16-30-27(31-17)24(32)14-21-6-7-22(15-23(21)20-10-12-28(4,5)13-11-20)29(33)18(2)25-8-9-26(34-25)19(29)3/h6-7,10,15-16,18-19,25-26,33H,8-9,11-14H2,1-5H3,(H,30,31)/t18-,19+,25+,26?,29?/m0/s1 |
| InChIKey | QEIMLIPOPACUIL-COLMFVJASA-N |
| XLogP | 5.76 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |