C31H28N4O4S2 — CID 158521256
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(thiophen-2-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;thiophen-2-ylmethanamine (PubChem CID 158521256) has the molecular formula C31H28N4O4S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(thiophen-2-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;thiophen-2-ylmethanamine.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(thiophen-2-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 158521256 |
| Molecular Formula | C31H28N4O4S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(thiophen-2-ylmethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione;thiophen-2-ylmethanamine |
| SMILES | NCc1cccs1.O=C1[C@H]2Cc3c([nH]c4ccccc34)[C@@H](c3ccc4c(c3)OCO4)N2C(=O)CN1Cc1cccs1 |
| InChI | InChI=1S/C26H21N3O4S.C5H7NS/c30-23-13-28(12-16-4-3-9-34-16)26(31)20-11-18-17-5-1-2-6-19(17)27-24(18)25(29(20)23)15-7-8-21-22(10-15)33-14-32-21;6-4-5-2-1-3-7-5/h1-10,20,25,27H,11-14H2;1-3H,4,6H2/t20-,25-;/m1./s1 |
| InChIKey | HMFYEDXYWYVJOE-RGFBGPCLSA-N |
| XLogP | 5.05 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|