C27H52O7Si2 — CID 158521782
methyl 2-[(1S,3R,8R,10S,12S,13R,14S)-6,6-ditert-butyl-13-[tert-butyl(dimethyl)silyl]oxy-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate (PubChem CID 158521782) has the molecular formula C27H52O7Si2 and a molecular weight of 544.88 g/mol. Its IUPAC name is methyl 2-[(1S,3R,8R,10S,12S,13R,14S)-6,6-ditert-butyl-13-[tert-butyl(dimethyl)silyl]oxy-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,8R,10S,12S,13R,14S)-6,6-ditert-butyl-13-[tert-butyl(dimethyl)silyl]oxy-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate |
|---|---|
| PubChem CID | 158521782 |
| Molecular Formula | C27H52O7Si2 |
| Molecular Weight | 544.88 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | methyl 2-[(1S,3R,8R,10S,12S,13R,14S)-6,6-ditert-butyl-13-[tert-butyl(dimethyl)silyl]oxy-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H]2C[C@H]3O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]3O[C@H]2[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O7Si2/c1-17-23-19(31-20(15-22(28)29-11)24(17)34-35(12,13)25(2,3)4)14-18-21(32-23)16-30-36(33-18,26(5,6)7)27(8,9)10/h17-21,23-24H,14-16H2,1-13H3/t17-,18+,19-,20-,21+,23-,24+/m0/s1 |
| InChIKey | WTBPERNBLFYDLV-YNALQIKGSA-N |
| XLogP | 5.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.88 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|