C27H31Br2FN2O3 — CID 158522948
N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-4-[2-(2-methoxyethoxy)ethoxy]aniline;methane (PubChem CID 158522948) has the molecular formula C27H31Br2FN2O3 and a molecular weight of 610.36 g/mol. Its IUPAC name is N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-4-[2-(2-methoxyethoxy)ethoxy]aniline;methane.
| Compound Name | N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-4-[2-(2-methoxyethoxy)ethoxy]aniline;methane |
|---|---|
| PubChem CID | 158522948 |
| Molecular Formula | C27H31Br2FN2O3 |
| Molecular Weight | 610.36 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-4-[2-(2-methoxyethoxy)ethoxy]aniline;methane |
| SMILES | C.COCCOCCOc1ccc(NCC(F)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C26H27Br2FN2O3.CH4/c1-32-10-11-33-12-13-34-22-6-4-21(5-7-22)30-16-20(29)17-31-25-8-2-18(27)14-23(25)24-15-19(28)3-9-26(24)31;/h2-9,14-15,20,30H,10-13,16-17H2,1H3;1H4 |
| InChIKey | HMLCMQJCJQWWNE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 44.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.36 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|