C19H23N5O2 — CID 158525036
4-methyl-N-[5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 158525036) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-methyl-N-[5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-methyl-N-[5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 158525036 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-methyl-N-[5-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC1=CCN(C(=O)Nc2nnc(-c3ccc(N4CCCC4)cc3)o2)CC1 |
| InChI | InChI=1S/C19H23N5O2/c1-14-8-12-24(13-9-14)19(25)20-18-22-21-17(26-18)15-4-6-16(7-5-15)23-10-2-3-11-23/h4-8H,2-3,9-13H2,1H3,(H,20,22,25) |
| InChIKey | HMRNOAPGYOAANJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|