About 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine
7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine (PubChem CID 158526538) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 158526538 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC1=NCc2c(N)ncnc21 |
| InChI | InChI=1S/C7H8N4/c1-4-6-5(2-9-4)7(8)11-3-10-6/h3H,2H2,1H3,(H2,8,10,11) |
| InChIKey | LBPOGMYQWDMBNC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine (CID 158526538) is 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine is CC1=NCc2c(N)ncnc21.
What is the InChIKey of 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine?
The InChIKey is LBPOGMYQWDMBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-4-6-5(2-9-4)7(8)11-3-10-6/h3H,2H2,1H3,(H2,8,10,11).
What are the key properties of 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine?
7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine has a molecular weight of 148.17 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5H-pyrrolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 158526538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).