C6H10F3NO3 — CID 15852922
N-methyl-N-(3,3,3-trifluoro-2,2-dihydroxypropyl)acetamide (PubChem CID 15852922) has the molecular formula C6H10F3NO3 and a molecular weight of 201.14 g/mol. Its IUPAC name is N-methyl-N-(3,3,3-trifluoro-2,2-dihydroxypropyl)acetamide.
| Compound Name | N-methyl-N-(3,3,3-trifluoro-2,2-dihydroxypropyl)acetamide |
|---|---|
| PubChem CID | 15852922 |
| Molecular Formula | C6H10F3NO3 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-methyl-N-(3,3,3-trifluoro-2,2-dihydroxypropyl)acetamide |
| SMILES | CC(=O)N(C)CC(O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO3/c1-4(11)10(2)3-5(12,13)6(7,8)9/h12-13H,3H2,1-2H3 |
| InChIKey | SVUJBVSRYGZNBE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|