About tripropan-2-yl tri(propan-2-yloxy)silyl silicate
tripropan-2-yl tri(propan-2-yloxy)silyl silicate (PubChem CID 15853008) has the molecular formula C18H42O7Si2
and a molecular weight of 426.70 g/mol. Its IUPAC name is tripropan-2-yl tri(propan-2-yloxy)silyl silicate.
Molecular Properties
| Compound Name | tripropan-2-yl tri(propan-2-yloxy)silyl silicate |
| PubChem CID | 15853008 |
| Molecular Formula | C18H42O7Si2 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | tripropan-2-yl tri(propan-2-yloxy)silyl silicate |
| SMILES | CC(C)O[Si](OC(C)C)(OC(C)C)O[Si](OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C18H42O7Si2/c1-13(2)19-26(20-14(3)4,21-15(5)6)25-27(22-16(7)8,23-17(9)10)24-18(11)12/h13-18H,1-12H3 |
| InChIKey | WMXIRKZZODISHP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tripropan-2-yl tri(propan-2-yloxy)silyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripropan-2-yl tri(propan-2-yloxy)silyl silicate?
The IUPAC name of tripropan-2-yl tri(propan-2-yloxy)silyl silicate (CID 15853008) is tripropan-2-yl tri(propan-2-yloxy)silyl silicate.
What is the SMILES notation for tripropan-2-yl tri(propan-2-yloxy)silyl silicate?
The canonical SMILES for tripropan-2-yl tri(propan-2-yloxy)silyl silicate is CC(C)O[Si](OC(C)C)(OC(C)C)O[Si](OC(C)C)(OC(C)C)OC(C)C.
What is the InChIKey of tripropan-2-yl tri(propan-2-yloxy)silyl silicate?
The InChIKey is WMXIRKZZODISHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42O7Si2/c1-13(2)19-26(20-14(3)4,21-15(5)6)25-27(22-16(7)8,23-17(9)10)24-18(11)12/h13-18H,1-12H3.
What are the key properties of tripropan-2-yl tri(propan-2-yloxy)silyl silicate?
tripropan-2-yl tri(propan-2-yloxy)silyl silicate has a molecular weight of 426.70 g/mol, XLogP of 4.42, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tripropan-2-yl tri(propan-2-yloxy)silyl silicate is sourced from PubChem (CID 15853008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).