C31H46O5 — CID 158531297
2,6-dimethylhept-5-enal;3-hydroxycyclohex-2-en-1-one;2-methyl-2-(4-methylpent-3-enyl)-7,8-dihydro-6H-chromen-5-one (PubChem CID 158531297) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is 2,6-dimethylhept-5-enal;3-hydroxycyclohex-2-en-1-one;2-methyl-2-(4-methylpent-3-enyl)-7,8-dihydro-6H-chromen-5-one.
| Compound Name | 2,6-dimethylhept-5-enal;3-hydroxycyclohex-2-en-1-one;2-methyl-2-(4-methylpent-3-enyl)-7,8-dihydro-6H-chromen-5-one |
|---|---|
| PubChem CID | 158531297 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 2,6-dimethylhept-5-enal;3-hydroxycyclohex-2-en-1-one;2-methyl-2-(4-methylpent-3-enyl)-7,8-dihydro-6H-chromen-5-one |
| SMILES | CC(C)=CCCC(C)C=O.CC(C)=CCCC1(C)C=CC2=C(CCCC2=O)O1.O=C1C=C(O)CCC1 |
| InChI | InChI=1S/C16H22O2.C9H16O.C6H8O2/c1-12(2)6-5-10-16(3)11-9-13-14(17)7-4-8-15(13)18-16;1-8(2)5-4-6-9(3)7-10;7-5-2-1-3-6(8)4-5/h6,9,11H,4-5,7-8,10H2,1-3H3;5,7,9H,4,6H2,1-3H3;4,7H,1-3H2 |
| InChIKey | HNKCZUXTHIBLKA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|