C17H16IN5O3 — CID 158531669
6-(hydroxymethyl)-2-iodo-5-[2-(4-isocyanophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 158531669) has the molecular formula C17H16IN5O3 and a molecular weight of 465.25 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2-iodo-5-[2-(4-isocyanophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | 6-(hydroxymethyl)-2-iodo-5-[2-(4-isocyanophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 158531669 |
| Molecular Formula | C17H16IN5O3 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 6-(hydroxymethyl)-2-iodo-5-[2-(4-isocyanophenyl)acetyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(CC(=O)N2Cc3c(C(N)=O)c(I)nn3CC2CO)cc1 |
| InChI | InChI=1S/C17H16IN5O3/c1-20-11-4-2-10(3-5-11)6-14(25)22-8-13-15(17(19)26)16(18)21-23(13)7-12(22)9-24/h2-5,12,24H,6-9H2,(H2,19,26) |
| InChIKey | RXJRAMZWDZPTNC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|