C22H36I2O8 — CID 158532576
tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate;2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;molecular iodine (PubChem CID 158532576) has the molecular formula C22H36I2O8 and a molecular weight of 682.33 g/mol. Its IUPAC name is tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate;2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;molecular iodine.
| Compound Name | tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate;2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;molecular iodine |
|---|---|
| PubChem CID | 158532576 |
| Molecular Formula | C22H36I2O8 |
| Molecular Weight | 682.33 g/mol |
| Exact Mass | 682.05 |
| IUPAC Name | tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate;2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;molecular iodine |
| SMILES | C=CCC(C(=O)O)C1(C)OCCO1.C=CCC(C(=O)OC(C)(C)C)C1(C)OCCO1.II |
| InChI | InChI=1S/C13H22O4.C9H14O4.I2/c1-6-7-10(11(14)17-12(2,3)4)13(5)15-8-9-16-13;1-3-4-7(8(10)11)9(2)12-5-6-13-9;1-2/h6,10H,1,7-9H2,2-5H3;3,7H,1,4-6H2,2H3,(H,10,11); |
| InChIKey | HNNXPSMCOWVGKW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|