About 1-bromo-3-ethylbenzene;methane
1-bromo-3-ethylbenzene;methane (PubChem CID 158533972) has the molecular formula C9H13Br
and a molecular weight of 201.11 g/mol. Its IUPAC name is 1-bromo-3-ethylbenzene;methane.
Molecular Properties
| Compound Name | 1-bromo-3-ethylbenzene;methane |
| PubChem CID | 158533972 |
| Molecular Formula | C9H13Br |
| Molecular Weight | 201.11 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1-bromo-3-ethylbenzene;methane |
| SMILES | C.CCc1cccc(Br)c1 |
| InChI | InChI=1S/C8H9Br.CH4/c1-2-7-4-3-5-8(9)6-7;/h3-6H,2H2,1H3;1H4 |
| InChIKey | HNSHEMALZMYLEX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.11 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-ethylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-ethylbenzene;methane?
The IUPAC name of 1-bromo-3-ethylbenzene;methane (CID 158533972) is 1-bromo-3-ethylbenzene;methane.
What is the SMILES notation for 1-bromo-3-ethylbenzene;methane?
The canonical SMILES for 1-bromo-3-ethylbenzene;methane is C.CCc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-ethylbenzene;methane?
The InChIKey is HNSHEMALZMYLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br.CH4/c1-2-7-4-3-5-8(9)6-7;/h3-6H,2H2,1H3;1H4.
What are the key properties of 1-bromo-3-ethylbenzene;methane?
1-bromo-3-ethylbenzene;methane has a molecular weight of 201.11 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-ethylbenzene;methane is sourced from PubChem (CID 158533972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).