C21H27NOSi — CID 15853429
(3S,4S,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one (PubChem CID 15853429) has the molecular formula C21H27NOSi and a molecular weight of 337.54 g/mol. Its IUPAC name is (3S,4S,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one.
| Compound Name | (3S,4S,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15853429 |
| Molecular Formula | C21H27NOSi |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (3S,4S,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)c2ccccc2)[C@@H](C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H27NOSi/c1-16-20(24(3,4)19-13-9-6-10-14-19)17(2)22(21(16)23)15-18-11-7-5-8-12-18/h5-14,16-17,20H,15H2,1-4H3/t16-,17-,20+/m1/s1 |
| InChIKey | GQSYWNCLZNYJJT-HLIPFELVSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|