C13H14FN — CID 158535136
6-fluoro-2,3,4,9-tetrahydro-1H-fluoren-1-amine (PubChem CID 158535136) has the molecular formula C13H14FN and a molecular weight of 203.26 g/mol. Its IUPAC name is 6-fluoro-2,3,4,9-tetrahydro-1H-fluoren-1-amine.
| Compound Name | 6-fluoro-2,3,4,9-tetrahydro-1H-fluoren-1-amine |
|---|---|
| PubChem CID | 158535136 |
| Molecular Formula | C13H14FN |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 6-fluoro-2,3,4,9-tetrahydro-1H-fluoren-1-amine |
| SMILES | NC1CCCC2=C1Cc1ccc(F)cc12 |
| InChI | InChI=1S/C13H14FN/c14-9-5-4-8-6-12-10(11(8)7-9)2-1-3-13(12)15/h4-5,7,13H,1-3,6,15H2 |
| InChIKey | UXUKODWPNVXVGV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |