C15H18N4OS — CID 15853548
(7Z)-7-benzylidene-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one (PubChem CID 15853548) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is (7Z)-7-benzylidene-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one.
| Compound Name | (7Z)-7-benzylidene-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one |
|---|---|
| PubChem CID | 15853548 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (7Z)-7-benzylidene-3,3-diethyl-2,4-dihydro-[1,3]thiazolo[3,2-b][1,2,4,5]tetrazin-6-one |
| SMILES | CCC1(CC)NN=c2s/c(=C\c3ccccc3)c(=O)n2N1 |
| InChI | InChI=1S/C15H18N4OS/c1-3-15(4-2)17-16-14-19(18-15)13(20)12(21-14)10-11-8-6-5-7-9-11/h5-10,17-18H,3-4H2,1-2H3/b12-10- |
| InChIKey | UYVVTGLNYSJRFC-BENRWUELSA-N |
| XLogP | 0.94 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |