C6H14N4S — CID 15853558
6,6-diethyl-1,2,4,5-tetrazinane-3-thione (PubChem CID 15853558) has the molecular formula C6H14N4S and a molecular weight of 174.27 g/mol. Its IUPAC name is 6,6-diethyl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 6,6-diethyl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 15853558 |
| Molecular Formula | C6H14N4S |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 6,6-diethyl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CCC1(CC)NNC(=S)NN1 |
| InChI | InChI=1S/C6H14N4S/c1-3-6(4-2)9-7-5(11)8-10-6/h9-10H,3-4H2,1-2H3,(H2,7,8,11) |
| InChIKey | VFBXWVANGYOEMI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|