C23H34ClN3O3 — CID 158535693
methyl N-[(3Z)-1-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]hexa-3,5-dien-3-yl]methanimidate;hydrochloride (PubChem CID 158535693) has the molecular formula C23H34ClN3O3 and a molecular weight of 436.00 g/mol. Its IUPAC name is methyl N-[(3Z)-1-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]hexa-3,5-dien-3-yl]methanimidate;hydrochloride.
| Compound Name | methyl N-[(3Z)-1-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]hexa-3,5-dien-3-yl]methanimidate;hydrochloride |
|---|---|
| PubChem CID | 158535693 |
| Molecular Formula | C23H34ClN3O3 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | methyl N-[(3Z)-1-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-2-methyl-3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]hexa-3,5-dien-3-yl]methanimidate;hydrochloride |
| SMILES | C=C/C=C\C=C\N1CC2(CCN(CCC(=C/C=C)/N=C/OC)CC2)OC(C)C1=O.Cl |
| InChI | InChI=1S/C23H33N3O3.ClH/c1-5-7-8-9-14-26-18-23(29-20(3)22(26)27)12-16-25(17-13-23)15-11-21(10-6-2)24-19-28-4;/h5-10,14,19-20H,1-2,11-13,15-18H2,3-4H3;1H/b8-7-,14-9+,21-10-,24-19+; |
| InChIKey | KERXBDMREBOESL-VKYCOLRVSA-N |
| XLogP | 3.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|