C3H3N3S4 — CID 158536185
1-sulfanyl-1,3,5-triazinane-2,4,6-trithione (PubChem CID 158536185) has the molecular formula C3H3N3S4 and a molecular weight of 209.35 g/mol. Its IUPAC name is 1-sulfanyl-1,3,5-triazinane-2,4,6-trithione.
| Compound Name | 1-sulfanyl-1,3,5-triazinane-2,4,6-trithione |
|---|---|
| PubChem CID | 158536185 |
| Molecular Formula | C3H3N3S4 |
| Molecular Weight | 209.35 g/mol |
| Exact Mass | 208.92 |
| IUPAC Name | 1-sulfanyl-1,3,5-triazinane-2,4,6-trithione |
| SMILES | S=c1[nH]c(=S)n(S)c(=S)[nH]1 |
| InChI | InChI=1S/C3H3N3S4/c7-1-4-2(8)6(10)3(9)5-1/h10H,(H2,4,5,7,8,9) |
| InChIKey | HNYWJIMRNLGSPG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|