C16H37N — CID 158536756
butane;1,2,2,4,6,6-hexamethylpiperidine;methane (PubChem CID 158536756) has the molecular formula C16H37N and a molecular weight of 243.48 g/mol. Its IUPAC name is butane;1,2,2,4,6,6-hexamethylpiperidine;methane.
| Compound Name | butane;1,2,2,4,6,6-hexamethylpiperidine;methane |
|---|---|
| PubChem CID | 158536756 |
| Molecular Formula | C16H37N |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 243.29 |
| IUPAC Name | butane;1,2,2,4,6,6-hexamethylpiperidine;methane |
| SMILES | C.CC1CC(C)(C)N(C)C(C)(C)C1.CCCC |
| InChI | InChI=1S/C11H23N.C4H10.CH4/c1-9-7-10(2,3)12(6)11(4,5)8-9;1-3-4-2;/h9H,7-8H2,1-6H3;3-4H2,1-2H3;1H4 |
| InChIKey | HOAOLIPZMFFBOX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |