About methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine
methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine (PubChem CID 158536881) has the molecular formula C10H21F3N2
and a molecular weight of 226.29 g/mol. Its IUPAC name is methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine |
| PubChem CID | 158536881 |
| Molecular Formula | C10H21F3N2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine |
| SMILES | C.CN(CCCC(F)(F)F)[C@H]1CCNC1 |
| InChI | InChI=1S/C9H17F3N2.CH4/c1-14(8-3-5-13-7-8)6-2-4-9(10,11)12;/h8,13H,2-7H2,1H3;1H4/t8-;/m0./s1 |
| InChIKey | HOAWYRBDITYHGC-QRPNPIFTSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine?
The IUPAC name of methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine (CID 158536881) is methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine.
What is the SMILES notation for methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine?
The canonical SMILES for methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine is C.CN(CCCC(F)(F)F)[C@H]1CCNC1.
What is the InChIKey of methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine?
The InChIKey is HOAWYRBDITYHGC-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H17F3N2.CH4/c1-14(8-3-5-13-7-8)6-2-4-9(10,11)12;/h8,13H,2-7H2,1H3;1H4/t8-;/m0./s1.
What are the key properties of methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine?
methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine has a molecular weight of 226.29 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(3S)-N-methyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine is sourced from PubChem (CID 158536881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).