C37H56O12 — CID 158538108
diethyl 2,2-bis(prop-2-enyl)propanedioate;diethyl cyclopent-3-ene-1,1-dicarboxylate;diethyl 3-methyl-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 158538108) has the molecular formula C37H56O12 and a molecular weight of 692.84 g/mol. Its IUPAC name is diethyl 2,2-bis(prop-2-enyl)propanedioate;diethyl cyclopent-3-ene-1,1-dicarboxylate;diethyl 3-methyl-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 2,2-bis(prop-2-enyl)propanedioate;diethyl cyclopent-3-ene-1,1-dicarboxylate;diethyl 3-methyl-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 158538108 |
| Molecular Formula | C37H56O12 |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.38 |
| IUPAC Name | diethyl 2,2-bis(prop-2-enyl)propanedioate;diethyl cyclopent-3-ene-1,1-dicarboxylate;diethyl 3-methyl-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CC1C.C=CCC(CC=C)(C(=O)OCC)C(=O)OCC.CCOC(=O)C1(C(=O)OCC)CC=CC1 |
| InChI | InChI=1S/2C13H20O4.C11H16O4/c1-5-16-11(14)13(12(15)17-6-2)7-9(3)10(4)8-13;1-5-9-13(10-6-2,11(14)16-7-3)12(15)17-8-4;1-3-14-9(12)11(7-5-6-8-11)10(13)15-4-2/h10H,3,5-8H2,1-2,4H3;5-6H,1-2,7-10H2,3-4H3;5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | HOENRHXBUSRCKA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|