C6H11AlFN3S2 — CID 158538730
4-alumanyl-1-(3-fluoropropyl)-2-methyl-1,2,4-triazolidine-3,5-dithione (PubChem CID 158538730) has the molecular formula C6H11AlFN3S2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-alumanyl-1-(3-fluoropropyl)-2-methyl-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-alumanyl-1-(3-fluoropropyl)-2-methyl-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 158538730 |
| Molecular Formula | C6H11AlFN3S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-alumanyl-1-(3-fluoropropyl)-2-methyl-1,2,4-triazolidine-3,5-dithione |
| SMILES | Cn1c(=S)n([AlH2])c(=S)n1CCCF |
| InChI | InChI=1S/C6H10FN3S2.Al.2H/c1-9-5(11)8-6(12)10(9)4-2-3-7;;;/h2-4H2,1H3,(H,8,11,12);;;/q;+1;;/p-1 |
| InChIKey | HOGKNBIHHMFZAK-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|