C15H16ClN3 — CID 158538764
4-(4-chlorophenyl)-6-(cyclobutylmethyl)pyrimidin-2-amine (PubChem CID 158538764) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-(cyclobutylmethyl)pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-6-(cyclobutylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 158538764 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-(4-chlorophenyl)-6-(cyclobutylmethyl)pyrimidin-2-amine |
| SMILES | Nc1nc(CC2CCC2)cc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H16ClN3/c16-12-6-4-11(5-7-12)14-9-13(18-15(17)19-14)8-10-2-1-3-10/h4-7,9-10H,1-3,8H2,(H2,17,18,19) |
| InChIKey | WGYQOGWSMZNFNH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |