C28H31N7 — CID 158539289
4-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]methyl]phenyl]-1,4-diazabicyclo[3.2.2]nonane (PubChem CID 158539289) has the molecular formula C28H31N7 and a molecular weight of 465.61 g/mol. Its IUPAC name is 4-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]methyl]phenyl]-1,4-diazabicyclo[3.2.2]nonane.
| Compound Name | 4-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]methyl]phenyl]-1,4-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 158539289 |
| Molecular Formula | C28H31N7 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 4-[4-[[4-(1-ethyl-3-pyridin-3-ylpyrazol-4-yl)pyrimidin-2-yl]methyl]phenyl]-1,4-diazabicyclo[3.2.2]nonane |
| SMILES | CCn1cc(-c2ccnc(Cc3ccc(N4CCN5CCC4CC5)cc3)n2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C28H31N7/c1-2-34-20-25(28(32-34)22-4-3-12-29-19-22)26-9-13-30-27(31-26)18-21-5-7-23(8-6-21)35-17-16-33-14-10-24(35)11-15-33/h3-9,12-13,19-20,24H,2,10-11,14-18H2,1H3 |
| InChIKey | HOHZRVHCDCRDLI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|