About methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate
methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate (PubChem CID 158539883) has the molecular formula C14H16ClNO8S4
and a molecular weight of 490.00 g/mol. Its IUPAC name is methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate |
| PubChem CID | 158539883 |
| Molecular Formula | C14H16ClNO8S4 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 488.94 |
| IUPAC Name | methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(C)c(S(=O)(=O)Cl)s1.COC(=O)c1cc(C)c(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H7ClO4S2.C7H9NO4S2/c2*1-4-3-5(6(9)12-2)13-7(4)14(8,10)11/h3H,1-2H3;3H,1-2H3,(H2,8,10,11) |
| InChIKey | HOJUGCHBOMQGPT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate?
The IUPAC name of methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate (CID 158539883) is methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate.
What is the SMILES notation for methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate?
The canonical SMILES for methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate is COC(=O)c1cc(C)c(S(=O)(=O)Cl)s1.COC(=O)c1cc(C)c(S(N)(=O)=O)s1.
What is the InChIKey of methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate?
The InChIKey is HOJUGCHBOMQGPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO4S2.C7H9NO4S2/c2*1-4-3-5(6(9)12-2)13-7(4)14(8,10)11/h3H,1-2H3;3H,1-2H3,(H2,8,10,11).
What are the key properties of methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate?
methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate has a molecular weight of 490.00 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chlorosulfonyl-4-methylthiophene-2-carboxylate;methyl 4-methyl-5-sulfamoylthiophene-2-carboxylate is sourced from PubChem (CID 158539883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).