About 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one
1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one (PubChem CID 158540248) has the molecular formula C18H29NO5S
and a molecular weight of 371.50 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one.
Molecular Properties
| Compound Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one |
| PubChem CID | 158540248 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one |
| SMILES | CC(C)(C)c1cc(CCC(=O)C(C)(C)S(=O)(=O)C2CCOCC2)on1 |
| InChI | InChI=1S/C18H29NO5S/c1-17(2,3)15-12-13(24-19-15)6-7-16(20)18(4,5)25(21,22)14-8-10-23-11-9-14/h12,14H,6-11H2,1-5H3 |
| InChIKey | HYNFZVJZSHLIBN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one?
The IUPAC name of 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one (CID 158540248) is 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one.
What is the SMILES notation for 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one?
The canonical SMILES for 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one is CC(C)(C)c1cc(CCC(=O)C(C)(C)S(=O)(=O)C2CCOCC2)on1.
What is the InChIKey of 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one?
The InChIKey is HYNFZVJZSHLIBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO5S/c1-17(2,3)15-12-13(24-19-15)6-7-16(20)18(4,5)25(21,22)14-8-10-23-11-9-14/h12,14H,6-11H2,1-5H3.
What are the key properties of 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one?
1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one has a molecular weight of 371.50 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tert-butyl-1,2-oxazol-5-yl)-4-methyl-4-(oxan-4-ylsulfonyl)pentan-3-one is sourced from PubChem (CID 158540248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).