C12H15N3O6 — CID 158540944
1,3,5-tris(oxetan-2-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 158540944) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 1,3,5-tris(oxetan-2-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(oxetan-2-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 158540944 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1,3,5-tris(oxetan-2-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(C2CCO2)c(=O)n(C2CCO2)c(=O)n1C1CCO1 |
| InChI | InChI=1S/C12H15N3O6/c16-10-13(7-1-4-19-7)11(17)15(9-3-6-21-9)12(18)14(10)8-2-5-20-8/h7-9H,1-6H2 |
| InChIKey | HOMYAJGOZUNOSA-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |