C31H32Br3N7O6 — CID 158541459
1-bromo-3-(bromomethyl)benzene;7-[(3-bromophenyl)methyl]-8-(hydroxymethyl)-1,3-dimethylpurine-2,6-dione;6-(hydroxymethyl)-1,3-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 158541459) has the molecular formula C31H32Br3N7O6 and a molecular weight of 838.35 g/mol. Its IUPAC name is 1-bromo-3-(bromomethyl)benzene;7-[(3-bromophenyl)methyl]-8-(hydroxymethyl)-1,3-dimethylpurine-2,6-dione;6-(hydroxymethyl)-1,3-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-bromo-3-(bromomethyl)benzene;7-[(3-bromophenyl)methyl]-8-(hydroxymethyl)-1,3-dimethylpurine-2,6-dione;6-(hydroxymethyl)-1,3-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158541459 |
| Molecular Formula | C31H32Br3N7O6 |
| Molecular Weight | 838.35 g/mol |
| Exact Mass | 835.00 |
| IUPAC Name | 1-bromo-3-(bromomethyl)benzene;7-[(3-bromophenyl)methyl]-8-(hydroxymethyl)-1,3-dimethylpurine-2,6-dione;6-(hydroxymethyl)-1,3-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | BrCc1cccc(Br)c1.Cn1c(=O)c2c(nc(CO)n2Cc2cccc(Br)c2)n(C)c1=O.Cn1c2c(c(=O)n(C)c1=O)CC(CO)=N2 |
| InChI | InChI=1S/C15H15BrN4O3.C9H11N3O3.C7H6Br2/c1-18-13-12(14(22)19(2)15(18)23)20(11(8-21)17-13)7-9-4-3-5-10(16)6-9;1-11-7-6(3-5(4-13)10-7)8(14)12(2)9(11)15;8-5-6-2-1-3-7(9)4-6/h3-6,21H,7-8H2,1-2H3;13H,3-4H2,1-2H3;1-4H,5H2 |
| InChIKey | HOOLNXHGXDLPFQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 158.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|