About bis(2,3-dihydroxypropylazanium);sulfate
bis(2,3-dihydroxypropylazanium);sulfate (PubChem CID 158543756) has the molecular formula C6H20N2O8S
and a molecular weight of 280.30 g/mol. Its IUPAC name is bis(2,3-dihydroxypropylazanium);sulfate.
Molecular Properties
| Compound Name | bis(2,3-dihydroxypropylazanium);sulfate |
| PubChem CID | 158543756 |
| Molecular Formula | C6H20N2O8S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | bis(2,3-dihydroxypropylazanium);sulfate |
| SMILES | O=S(=O)([O-])[O-].[NH3+]CC(O)CO.[NH3+]CC(O)CO |
| InChI | InChI=1S/2C3H9NO2.H2O4S/c2*4-1-3(6)2-5;1-5(2,3)4/h2*3,5-6H,1-2,4H2;(H2,1,2,3,4) |
| InChIKey | HOVSSRFZXDQHSV-UHFFFAOYSA-N |
| XLogP | -6.18 |
| TPSA | 216.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -6.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(2,3-dihydroxypropylazanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3-dihydroxypropylazanium);sulfate?
The IUPAC name of bis(2,3-dihydroxypropylazanium);sulfate (CID 158543756) is bis(2,3-dihydroxypropylazanium);sulfate.
What is the SMILES notation for bis(2,3-dihydroxypropylazanium);sulfate?
The canonical SMILES for bis(2,3-dihydroxypropylazanium);sulfate is O=S(=O)([O-])[O-].[NH3+]CC(O)CO.[NH3+]CC(O)CO.
What is the InChIKey of bis(2,3-dihydroxypropylazanium);sulfate?
The InChIKey is HOVSSRFZXDQHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H9NO2.H2O4S/c2*4-1-3(6)2-5;1-5(2,3)4/h2*3,5-6H,1-2,4H2;(H2,1,2,3,4).
What are the key properties of bis(2,3-dihydroxypropylazanium);sulfate?
bis(2,3-dihydroxypropylazanium);sulfate has a molecular weight of 280.30 g/mol, XLogP of -6.18, 4 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3-dihydroxypropylazanium);sulfate is sourced from PubChem (CID 158543756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).