C22H24BBrN2O2 — CID 158543807
4-bromo-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 158543807) has the molecular formula C22H24BBrN2O2 and a molecular weight of 439.16 g/mol. Its IUPAC name is 4-bromo-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 4-bromo-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 158543807 |
| Molecular Formula | C22H24BBrN2O2 |
| Molecular Weight | 439.16 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 4-bromo-1H-indole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | Brc1cccc2[nH]ccc12.CC1(C)OB(c2cccc3[nH]ccc23)OC1(C)C |
| InChI | InChI=1S/C14H18BNO2.C8H6BrN/c1-13(2)14(3,4)18-15(17-13)11-6-5-7-12-10(11)8-9-16-12;9-7-2-1-3-8-6(7)4-5-10-8/h5-9,16H,1-4H3;1-5,10H |
| InChIKey | HOVYGYQSXLNVIX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.16 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|