C26H29FN4O2S — CID 158544327
4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluorophenyl]-2-methylbut-3-yn-2-ol (PubChem CID 158544327) has the molecular formula C26H29FN4O2S and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluorophenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluorophenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 158544327 |
| Molecular Formula | C26H29FN4O2S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluorophenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cc(F)cc(C#CC(C)(C)O)c4)c3)s2)CC1 |
| InChI | InChI=1S/C26H29FN4O2S/c1-26(2,32)7-4-17-10-18(12-21(27)11-17)16-33-22-13-20(14-29-24(22)28)23-15-30-25(34-23)19-5-8-31(3)9-6-19/h10-15,19,32H,5-6,8-9,16H2,1-3H3,(H2,28,29) |
| InChIKey | HOXLBNIOXLNNMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|