C5H3F6N3 — CID 158548573
1,1,1,2,2,2-hexafluoroethane;1,3,5-triazine (PubChem CID 158548573) has the molecular formula C5H3F6N3 and a molecular weight of 219.09 g/mol. Its IUPAC name is 1,1,1,2,2,2-hexafluoroethane;1,3,5-triazine.
| Compound Name | 1,1,1,2,2,2-hexafluoroethane;1,3,5-triazine |
|---|---|
| PubChem CID | 158548573 |
| Molecular Formula | C5H3F6N3 |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 1,1,1,2,2,2-hexafluoroethane;1,3,5-triazine |
| SMILES | FC(F)(F)C(F)(F)F.c1ncncn1 |
| InChI | InChI=1S/C3H3N3.C2F6/c1-4-2-6-3-5-1;3-1(4,5)2(6,7)8/h1-3H; |
| InChIKey | HPKXFRJCZHTGFE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|