C29H37BrN2O3 — CID 158548786
methyl (3S)-3-[(2S)-2-[4-(8-bromo-4-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-5-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]-4-methylpentanoate (PubChem CID 158548786) has the molecular formula C29H37BrN2O3 and a molecular weight of 541.53 g/mol. Its IUPAC name is methyl (3S)-3-[(2S)-2-[4-(8-bromo-4-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-5-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]-4-methylpentanoate.
| Compound Name | methyl (3S)-3-[(2S)-2-[4-(8-bromo-4-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-5-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 158548786 |
| Molecular Formula | C29H37BrN2O3 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | methyl (3S)-3-[(2S)-2-[4-(8-bromo-4-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-5-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carbonyl]-4-methylpentanoate |
| SMILES | COC(=O)C[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(Br)c3c2C(C)C2CCCC32)C1)C(C)C |
| InChI | InChI=1S/C29H37BrN2O3/c1-16(2)22(14-26(33)35-4)29(34)32-12-6-9-25(32)24-13-18(15-31-24)20-10-11-23(30)28-21-8-5-7-19(21)17(3)27(20)28/h10-11,15-17,19,21-22,25H,5-9,12-14H2,1-4H3/t17?,19?,21?,22-,25-/m0/s1 |
| InChIKey | YXIWQYJHLPYFEB-BUWMHDKTSA-N |
| XLogP | 6.46 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |