C40H48 — CID 158549580
(4aS,11R,11aS,12S,12aS)-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11-[(4-prop-1-en-2-ylphenyl)methyl]-11,12-dihydro-1H-tetracene (PubChem CID 158549580) has the molecular formula C40H48 and a molecular weight of 528.82 g/mol. Its IUPAC name is (4aS,11R,11aS,12S,12aS)-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11-[(4-prop-1-en-2-ylphenyl)methyl]-11,12-dihydro-1H-tetracene.
| Compound Name | (4aS,11R,11aS,12S,12aS)-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11-[(4-prop-1-en-2-ylphenyl)methyl]-11,12-dihydro-1H-tetracene |
|---|---|
| PubChem CID | 158549580 |
| Molecular Formula | C40H48 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (4aS,11R,11aS,12S,12aS)-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11-[(4-prop-1-en-2-ylphenyl)methyl]-11,12-dihydro-1H-tetracene |
| SMILES | C=C(C)C1=C(C)C[C@@]2(C)[C@H](C)[C@]3(C)C(=C(C)[C@@]2(C)C1=C)C(=C)c1c(C)cccc1[C@H]3Cc1ccc(C(=C)C)cc1 |
| InChI | InChI=1S/C40H48/c1-23(2)32-19-17-31(18-20-32)21-34-33-16-14-15-25(5)36(33)27(7)37-29(9)40(13)28(8)35(24(3)4)26(6)22-38(40,11)30(10)39(34,37)12/h14-20,30,34H,1,3,7-8,21-22H2,2,4-6,9-13H3/t30-,34+,38-,39-,40+/m0/s1 |
| InChIKey | HPNXVNSZFWSFJA-FOAMTOHJSA-N |
| XLogP | 11.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |