About azane;nitro nitrate
azane;nitro nitrate (PubChem CID 158549991) has the molecular formula H3N3O5
and a molecular weight of 125.04 g/mol. Its IUPAC name is azane;nitro nitrate.
Molecular Properties
| Compound Name | azane;nitro nitrate |
| PubChem CID | 158549991 |
| Molecular Formula | H3N3O5 |
| Molecular Weight | 125.04 g/mol |
| Exact Mass | 125.01 |
| IUPAC Name | azane;nitro nitrate |
| SMILES | N.O=[N+]([O-])O[N+](=O)[O-] |
| InChI | InChI=1S/N2O5.H3N/c3-1(4)7-2(5)6;/h;1H3 |
| InChIKey | LLVVESDLEXJMAU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.04 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;nitro nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nitro nitrate?
The IUPAC name of azane;nitro nitrate (CID 158549991) is azane;nitro nitrate.
What is the SMILES notation for azane;nitro nitrate?
The canonical SMILES for azane;nitro nitrate is N.O=[N+]([O-])O[N+](=O)[O-].
What is the InChIKey of azane;nitro nitrate?
The InChIKey is LLVVESDLEXJMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/N2O5.H3N/c3-1(4)7-2(5)6;/h;1H3.
What are the key properties of azane;nitro nitrate?
azane;nitro nitrate has a molecular weight of 125.04 g/mol, XLogP of -0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nitro nitrate is sourced from PubChem (CID 158549991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).