About CID 158550042
CID 158550042 (PubChem CID 158550042) has the molecular formula BFOPS+
and a molecular weight of 108.85 g/mol.
Molecular Properties
| Compound Name | CID 158550042 |
| PubChem CID | 158550042 |
| Molecular Formula | BFOPS+ |
| Molecular Weight | 108.85 g/mol |
| Exact Mass | 108.95 |
| IUPAC Name | — |
| SMILES | [B][P+](F)=S=O |
| InChI | InChI=1S/BFOPS/c1-4(2)5-3/q+1 |
| InChIKey | XOXDQZOBQCQXOR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.85 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 158550042 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158550042?
The IUPAC name of CID 158550042 (CID 158550042) is not available.
What is the SMILES notation for CID 158550042?
The canonical SMILES for CID 158550042 is [B][P+](F)=S=O.
What is the InChIKey of CID 158550042?
The InChIKey is XOXDQZOBQCQXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/BFOPS/c1-4(2)5-3/q+1.
What are the key properties of CID 158550042?
CID 158550042 has a molecular weight of 108.85 g/mol, XLogP of 0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158550042 is sourced from PubChem (CID 158550042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).