C28H30F3N3O — CID 158550416
1-phenyl-1-(2-phenyl-1-piperidin-3-ylpropyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 158550416) has the molecular formula C28H30F3N3O and a molecular weight of 481.56 g/mol. Its IUPAC name is 1-phenyl-1-(2-phenyl-1-piperidin-3-ylpropyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-phenyl-1-(2-phenyl-1-piperidin-3-ylpropyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 158550416 |
| Molecular Formula | C28H30F3N3O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 1-phenyl-1-(2-phenyl-1-piperidin-3-ylpropyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC(c1ccccc1)C(C1CCCNC1)N(C(=O)Nc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H30F3N3O/c1-20(21-9-4-2-5-10-21)26(22-11-8-18-32-19-22)34(25-12-6-3-7-13-25)27(35)33-24-16-14-23(15-17-24)28(29,30)31/h2-7,9-10,12-17,20,22,26,32H,8,11,18-19H2,1H3,(H,33,35) |
| InChIKey | HPQLFDZARVSFPK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |